C16H19N5O2 — CID 165021169
(2R,3R)-2-[[2-amino-7-(2H-pyrrol-3-yl)quinazolin-4-yl]amino]butane-1,3-diol (PubChem CID 165021169) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is (2R,3R)-2-[[2-amino-7-(2H-pyrrol-3-yl)quinazolin-4-yl]amino]butane-1,3-diol.
| Compound Name | (2R,3R)-2-[[2-amino-7-(2H-pyrrol-3-yl)quinazolin-4-yl]amino]butane-1,3-diol |
|---|---|
| PubChem CID | 165021169 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2R,3R)-2-[[2-amino-7-(2H-pyrrol-3-yl)quinazolin-4-yl]amino]butane-1,3-diol |
| SMILES | C[C@@H](O)[C@@H](CO)Nc1nc(N)nc2cc(C3=CC=NC3)ccc12 |
| InChI | InChI=1S/C16H19N5O2/c1-9(23)14(8-22)19-15-12-3-2-10(11-4-5-18-7-11)6-13(12)20-16(17)21-15/h2-6,9,14,22-23H,7-8H2,1H3,(H3,17,19,20,21)/t9-,14-/m1/s1 |
| InChIKey | LELCSCGVCAOPSS-YMTOWFKASA-N |
| XLogP | 0.83 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |