C37H47FN2O9 — CID 165021524
[3-[(1R,2S)-1-cyclopropyl-2-methyl-3-oxobutyl]phenyl] 4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propan-2-ylamino]methyl]benzoate (PubChem CID 165021524) has the molecular formula C37H47FN2O9 and a molecular weight of 682.79 g/mol. Its IUPAC name is [3-[(1R,2S)-1-cyclopropyl-2-methyl-3-oxobutyl]phenyl] 4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propan-2-ylamino]methyl]benzoate.
| Compound Name | [3-[(1R,2S)-1-cyclopropyl-2-methyl-3-oxobutyl]phenyl] 4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propan-2-ylamino]methyl]benzoate |
|---|---|
| PubChem CID | 165021524 |
| Molecular Formula | C37H47FN2O9 |
| Molecular Weight | 682.79 g/mol |
| Exact Mass | 682.33 |
| IUPAC Name | [3-[(1R,2S)-1-cyclopropyl-2-methyl-3-oxobutyl]phenyl] 4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propan-2-ylamino]methyl]benzoate |
| SMILES | COc1cc(-c2ccc(C(=O)Oc3cccc(C(C4CC4)[C@H](C)C(C)=O)c3)cc2CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(C)C)c(F)cn1 |
| InChI | InChI=1S/C37H47FN2O9/c1-20(2)40(18-31(43)35(45)36(46)32(44)19-41)17-26-13-25(11-12-28(26)29-15-33(48-5)39-16-30(29)38)37(47)49-27-8-6-7-24(14-27)34(23-9-10-23)21(3)22(4)42/h6-8,11-16,20-21,23,31-32,34-36,41,43-46H,9-10,17-19H2,1-5H3/t21-,31+,32-,34?,35-,36-/m1/s1 |
| InChIKey | BECBFFRBOHPROA-BCSMMHALSA-N |
| XLogP | 3.48 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|