C18H15ClN4O5 — CID 165024101
(3R)-3-[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-6-chloro-3H-2-benzofuran-1-one (PubChem CID 165024101) has the molecular formula C18H15ClN4O5 and a molecular weight of 402.79 g/mol. Its IUPAC name is (3R)-3-[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-6-chloro-3H-2-benzofuran-1-one.
| Compound Name | (3R)-3-[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-6-chloro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 165024101 |
| Molecular Formula | C18H15ClN4O5 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (3R)-3-[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-6-chloro-3H-2-benzofuran-1-one |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H]([C@@H]2OC(=O)c3cc(Cl)ccc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H15ClN4O5/c19-7-1-2-8-10(5-7)18(26)28-13(8)14-11(24)12(25)17(27-14)23-4-3-9-15(20)21-6-22-16(9)23/h1-6,11-14,17,24-25H,(H2,20,21,22)/t11-,12+,13+,14-,17+/m0/s1 |
| InChIKey | LPOAVJUYEHAZNY-GMIGGYDBSA-N |
| XLogP | 1.20 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |