About N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide
N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide (PubChem CID 165024286) has the molecular formula C9H19N2O2+
and a molecular weight of 187.26 g/mol. Its IUPAC name is N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide.
Molecular Properties
| Compound Name | N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide |
| PubChem CID | 165024286 |
| Molecular Formula | C9H19N2O2+ |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide |
| SMILES | CON(C)C(=O)C1CC[NH2+]CC1C |
| InChI | InChI=1S/C9H18N2O2/c1-7-6-10-5-4-8(7)9(12)11(2)13-3/h7-8,10H,4-6H2,1-3H3/p+1 |
| InChIKey | LQEUJZRFDSEDLT-UHFFFAOYSA-O |
| XLogP | -0.77 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide?
The IUPAC name of N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide (CID 165024286) is N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide.
What is the SMILES notation for N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide?
The canonical SMILES for N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide is CON(C)C(=O)C1CC[NH2+]CC1C.
What is the InChIKey of N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide?
The InChIKey is LQEUJZRFDSEDLT-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H18N2O2/c1-7-6-10-5-4-8(7)9(12)11(2)13-3/h7-8,10H,4-6H2,1-3H3/p+1.
What are the key properties of N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide?
N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide has a molecular weight of 187.26 g/mol, XLogP of -0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N,3-dimethylpiperidin-1-ium-4-carboxamide is sourced from PubChem (CID 165024286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).