C18H19N5 — CID 165025013
4-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3H-indol-2-yl]benzene-1,2-diamine (PubChem CID 165025013) has the molecular formula C18H19N5 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3H-indol-2-yl]benzene-1,2-diamine.
| Compound Name | 4-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3H-indol-2-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 165025013 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 4-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3H-indol-2-yl]benzene-1,2-diamine |
| SMILES | Nc1ccc(C2=Nc3ccc(C4=NCCCN4)cc3C2)cc1N |
| InChI | InChI=1S/C18H19N5/c19-14-4-2-11(9-15(14)20)17-10-13-8-12(3-5-16(13)23-17)18-21-6-1-7-22-18/h2-5,8-9H,1,6-7,10,19-20H2,(H,21,22) |
| InChIKey | LSZFBXYIQNWKPL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|