C23H27N5OS2 — CID 16502641
N-[4-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-2-yl]-N-phenylacetamide (PubChem CID 16502641) has the molecular formula C23H27N5OS2 and a molecular weight of 453.64 g/mol. Its IUPAC name is N-[4-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-2-yl]-N-phenylacetamide.
| Compound Name | N-[4-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 16502641 |
| Molecular Formula | C23H27N5OS2 |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[4-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
| SMILES | C=CCn1c(SCc2csc(N(C(C)=O)c3ccccc3)n2)nnc1C1CCCCC1 |
| InChI | InChI=1S/C23H27N5OS2/c1-3-14-27-21(18-10-6-4-7-11-18)25-26-23(27)31-16-19-15-30-22(24-19)28(17(2)29)20-12-8-5-9-13-20/h3,5,8-9,12-13,15,18H,1,4,6-7,10-11,14,16H2,2H3 |
| InChIKey | YUIHGDSJBMBYJT-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|