C13H25FN2 — CID 165026796
N-ethyl-2-(6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)-N-methylethanamine (PubChem CID 165026796) has the molecular formula C13H25FN2 and a molecular weight of 228.35 g/mol. Its IUPAC name is N-ethyl-2-(6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)-N-methylethanamine.
| Compound Name | N-ethyl-2-(6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 165026796 |
| Molecular Formula | C13H25FN2 |
| Molecular Weight | 228.35 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | N-ethyl-2-(6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)-N-methylethanamine |
| SMILES | CCN(C)CCC1CNC2CC(F)CCC12 |
| InChI | InChI=1S/C13H25FN2/c1-3-16(2)7-6-10-9-15-13-8-11(14)4-5-12(10)13/h10-13,15H,3-9H2,1-2H3 |
| InChIKey | MACPYKQYTVTATB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |