C6H12O8P2 — CID 165027001
2-[2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethoxy]-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 165027001) has the molecular formula C6H12O8P2 and a molecular weight of 274.10 g/mol. Its IUPAC name is 2-[2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethoxy]-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-[2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethoxy]-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 165027001 |
| Molecular Formula | C6H12O8P2 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2-[2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethoxy]-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | O=P1(OCCOP2(=O)OCCO2)OCCO1 |
| InChI | InChI=1S/C6H12O8P2/c7-15(9-1-2-10-15)13-5-6-14-16(8)11-3-4-12-16/h1-6H2 |
| InChIKey | MAYVQIDMGFMIEN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|