C23H24N2O7S — CID 16502994
[2-(2-methoxy-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate (PubChem CID 16502994) has the molecular formula C23H24N2O7S and a molecular weight of 472.52 g/mol. Its IUPAC name is [2-(2-methoxy-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2-(2-methoxy-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16502994 |
| Molecular Formula | C23H24N2O7S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [2-(2-methoxy-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)COC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H24N2O7S/c1-30-20-10-9-17(33(28,29)25-11-5-2-6-12-25)14-18(20)24-22(26)15-31-23(27)21-13-16-7-3-4-8-19(16)32-21/h3-4,7-10,13-14H,2,5-6,11-12,15H2,1H3,(H,24,26) |
| InChIKey | FASJWUHORMVEIP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |