C12H22NNaO5S2 — CID 165030034
sodium;N-[2-(2-ethenylsulfonylethylsulfanyl)ethyl]propanamide;propanoate (PubChem CID 165030034) has the molecular formula C12H22NNaO5S2 and a molecular weight of 347.43 g/mol. Its IUPAC name is sodium;N-[2-(2-ethenylsulfonylethylsulfanyl)ethyl]propanamide;propanoate.
| Compound Name | sodium;N-[2-(2-ethenylsulfonylethylsulfanyl)ethyl]propanamide;propanoate |
|---|---|
| PubChem CID | 165030034 |
| Molecular Formula | C12H22NNaO5S2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | sodium;N-[2-(2-ethenylsulfonylethylsulfanyl)ethyl]propanamide;propanoate |
| SMILES | C=CS(=O)(=O)CCSCCNC(=O)CC.CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H17NO3S2.C3H6O2.Na/c1-3-9(11)10-5-6-14-7-8-15(12,13)4-2;1-2-3(4)5;/h4H,2-3,5-8H2,1H3,(H,10,11);2H2,1H3,(H,4,5);/q;;+1/p-1 |
| InChIKey | LUNKJUORTDBVDW-UHFFFAOYSA-M |
| XLogP | -3.05 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|