C21H35N5O11 — CID 165031768
5-[2-[2-[5-[2-(2-azidoethoxy)ethoxy]-2-oxopentoxy]ethoxy]ethylamino]-2-[(2-carboxyacetyl)amino]-5-oxopentanoic acid (PubChem CID 165031768) has the molecular formula C21H35N5O11 and a molecular weight of 533.54 g/mol. Its IUPAC name is 5-[2-[2-[5-[2-(2-azidoethoxy)ethoxy]-2-oxopentoxy]ethoxy]ethylamino]-2-[(2-carboxyacetyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-[2-[2-[5-[2-(2-azidoethoxy)ethoxy]-2-oxopentoxy]ethoxy]ethylamino]-2-[(2-carboxyacetyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 165031768 |
| Molecular Formula | C21H35N5O11 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 5-[2-[2-[5-[2-(2-azidoethoxy)ethoxy]-2-oxopentoxy]ethoxy]ethylamino]-2-[(2-carboxyacetyl)amino]-5-oxopentanoic acid |
| SMILES | [N-]=[N+]=NCCOCCOCCCC(=O)COCCOCCNC(=O)CCC(NC(=O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H35N5O11/c22-26-24-6-9-36-11-10-34-7-1-2-16(27)15-37-13-12-35-8-5-23-18(28)4-3-17(21(32)33)25-19(29)14-20(30)31/h17H,1-15H2,(H,23,28)(H,25,29)(H,30,31)(H,32,33) |
| InChIKey | HVXNUUCKIGQLSJ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 235.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|