About 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene
2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene (PubChem CID 165033941) has the molecular formula C24H34
and a molecular weight of 322.54 g/mol. Its IUPAC name is 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene |
| PubChem CID | 165033941 |
| Molecular Formula | C24H34 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene |
| SMILES | CCC(C)C(c1c(C)cccc1C)C(CC)c1c(C)cccc1C |
| InChI | InChI=1S/C24H34/c1-8-16(3)24(23-19(6)14-11-15-20(23)7)21(9-2)22-17(4)12-10-13-18(22)5/h10-16,21,24H,8-9H2,1-7H3 |
| InChIKey | NCAMWEJXDNJQJG-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene?
The IUPAC name of 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene (CID 165033941) is 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene.
What is the SMILES notation for 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene?
The canonical SMILES for 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene is CCC(C)C(c1c(C)cccc1C)C(CC)c1c(C)cccc1C.
What is the InChIKey of 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene?
The InChIKey is NCAMWEJXDNJQJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34/c1-8-16(3)24(23-19(6)14-11-15-20(23)7)21(9-2)22-17(4)12-10-13-18(22)5/h10-16,21,24H,8-9H2,1-7H3.
What are the key properties of 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene?
2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene has a molecular weight of 322.54 g/mol, XLogP of 7.24, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-butan-2-yl-2-(2,6-dimethylphenyl)butyl]-1,3-dimethylbenzene is sourced from PubChem (CID 165033941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).