C35H30N4O2S — CID 165035885
3-[[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-4-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione (PubChem CID 165035885) has the molecular formula C35H30N4O2S and a molecular weight of 570.72 g/mol. Its IUPAC name is 3-[[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-4-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione.
| Compound Name | 3-[[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-4-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione |
|---|---|
| PubChem CID | 165035885 |
| Molecular Formula | C35H30N4O2S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 3-[[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-4-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccc(/N=C4\C(=O)C(=O)C5CCCCC45)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C35H30N4O2S/c1-21-7-13-24(14-8-21)39(25-15-9-22(2)10-16-25)26-17-11-23(12-18-26)27-19-20-30(33-31(27)37-42-38-33)36-32-28-5-3-4-6-29(28)34(40)35(32)41/h7-20,28-29H,3-6H2,1-2H3/b36-32- |
| InChIKey | UNIWJTIYPRCIJH-HIELXXDYSA-N |
| XLogP | 8.48 |
| TPSA | 75.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|