About (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine
(2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine (PubChem CID 165035925) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine |
| PubChem CID | 165035925 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine |
| SMILES | C=C/C=C(/CNNC=C)N(CC)CCC |
| InChI | InChI=1S/C12H23N3/c1-5-9-12(11-14-13-7-3)15(8-4)10-6-2/h5,7,9,13-14H,1,3,6,8,10-11H2,2,4H3/b12-9- |
| InChIKey | NJLOQVUJXAMFEH-XFXZXTDPSA-N |
| XLogP | 2.03 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine?
The IUPAC name of (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine (CID 165035925) is (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine.
What is the SMILES notation for (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine?
The canonical SMILES for (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine is C=C/C=C(/CNNC=C)N(CC)CCC.
What is the InChIKey of (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine?
The InChIKey is NJLOQVUJXAMFEH-XFXZXTDPSA-N. The full InChI is InChI=1S/C12H23N3/c1-5-9-12(11-14-13-7-3)15(8-4)10-6-2/h5,7,9,13-14H,1,3,6,8,10-11H2,2,4H3/b12-9-.
What are the key properties of (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine?
(2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine has a molecular weight of 209.34 g/mol, XLogP of 2.03, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1-(2-ethenylhydrazinyl)-N-ethyl-N-propylpenta-2,4-dien-2-amine is sourced from PubChem (CID 165035925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).