C20H22O5 — CID 165037088
ethyl 2-[5-methyl-4-[2-(3,4,5-trimethylphenyl)acetyl]furan-2-yl]-2-oxoacetate (PubChem CID 165037088) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is ethyl 2-[5-methyl-4-[2-(3,4,5-trimethylphenyl)acetyl]furan-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[5-methyl-4-[2-(3,4,5-trimethylphenyl)acetyl]furan-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 165037088 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | ethyl 2-[5-methyl-4-[2-(3,4,5-trimethylphenyl)acetyl]furan-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(C(=O)Cc2cc(C)c(C)c(C)c2)c(C)o1 |
| InChI | InChI=1S/C20H22O5/c1-6-24-20(23)19(22)18-10-16(14(5)25-18)17(21)9-15-7-11(2)13(4)12(3)8-15/h7-8,10H,6,9H2,1-5H3 |
| InChIKey | RXBXZUIKZRPROP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|