About (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate
(7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate (PubChem CID 16503730) has the molecular formula C23H15BrN4O3S
and a molecular weight of 507.37 g/mol. Its IUPAC name is (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
| PubChem CID | 16503730 |
| Molecular Formula | C23H15BrN4O3S |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
| SMILES | O=C(OCc1cc(=O)n2cc(Br)ccc2n1)c1cc(-c2cccs2)nn1-c1ccccc1 |
| InChI | InChI=1S/C23H15BrN4O3S/c24-15-8-9-21-25-16(11-22(29)27(21)13-15)14-31-23(30)19-12-18(20-7-4-10-32-20)26-28(19)17-5-2-1-3-6-17/h1-13H,14H2 |
| InChIKey | YBUXCUNENRRHKF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate?
The IUPAC name of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate (CID 16503730) is (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate.
What is the SMILES notation for (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate?
The canonical SMILES for (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate is O=C(OCc1cc(=O)n2cc(Br)ccc2n1)c1cc(-c2cccs2)nn1-c1ccccc1.
What is the InChIKey of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate?
The InChIKey is YBUXCUNENRRHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15BrN4O3S/c24-15-8-9-21-25-16(11-22(29)27(21)13-15)14-31-23(30)19-12-18(20-7-4-10-32-20)26-28(19)17-5-2-1-3-6-17/h1-13H,14H2.
What are the key properties of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate?
(7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate has a molecular weight of 507.37 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate is sourced from PubChem (CID 16503730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).