C20H16Cl2N2O5S2 — CID 165037710
1-chloro-2-[(4-methoxyphenyl)methylsulfanyl]-4-nitrobenzene;2-chloro-5-nitrobenzenethiol (PubChem CID 165037710) has the molecular formula C20H16Cl2N2O5S2 and a molecular weight of 499.40 g/mol. Its IUPAC name is 1-chloro-2-[(4-methoxyphenyl)methylsulfanyl]-4-nitrobenzene;2-chloro-5-nitrobenzenethiol.
| Compound Name | 1-chloro-2-[(4-methoxyphenyl)methylsulfanyl]-4-nitrobenzene;2-chloro-5-nitrobenzenethiol |
|---|---|
| PubChem CID | 165037710 |
| Molecular Formula | C20H16Cl2N2O5S2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | 1-chloro-2-[(4-methoxyphenyl)methylsulfanyl]-4-nitrobenzene;2-chloro-5-nitrobenzenethiol |
| SMILES | COc1ccc(CSc2cc([N+](=O)[O-])ccc2Cl)cc1.O=[N+]([O-])c1ccc(Cl)c(S)c1 |
| InChI | InChI=1S/C14H12ClNO3S.C6H4ClNO2S/c1-19-12-5-2-10(3-6-12)9-20-14-8-11(16(17)18)4-7-13(14)15;7-5-2-1-4(8(9)10)3-6(5)11/h2-8H,9H2,1H3;1-3,11H |
| InChIKey | XPHLVARWOHDZES-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|