C19H23F4N — CID 165038189
(4Z)-6-[2-fluoro-5-methylidene-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-N,N,7-trimethylocta-1,4,6-trien-2-amine (PubChem CID 165038189) has the molecular formula C19H23F4N and a molecular weight of 341.39 g/mol. Its IUPAC name is (4Z)-6-[2-fluoro-5-methylidene-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-N,N,7-trimethylocta-1,4,6-trien-2-amine.
| Compound Name | (4Z)-6-[2-fluoro-5-methylidene-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-N,N,7-trimethylocta-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 165038189 |
| Molecular Formula | C19H23F4N |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (4Z)-6-[2-fluoro-5-methylidene-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-N,N,7-trimethylocta-1,4,6-trien-2-amine |
| SMILES | C=C1CC(C(/C=C\CC(=C)N(C)C)=C(C)C)=C(F)C=C1C(F)(F)F |
| InChI | InChI=1S/C19H23F4N/c1-12(2)15(9-7-8-14(4)24(5)6)16-10-13(3)17(11-18(16)20)19(21,22)23/h7,9,11H,3-4,8,10H2,1-2,5-6H3/b9-7- |
| InChIKey | NSEAFRZFVFONER-CLFYSBASSA-N |
| XLogP | 6.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|