About 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene
4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene (PubChem CID 165038300) has the molecular formula C15H24O3S
and a molecular weight of 284.42 g/mol. Its IUPAC name is 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene.
Molecular Properties
| Compound Name | 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene |
| PubChem CID | 165038300 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene |
| SMILES | CC1=CCC2(CC1)COC2.CC1=CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H14O.C6H10O2S/c1-8-2-4-9(5-3-8)6-10-7-9;1-6-2-4-9(7,8)5-3-6/h2H,3-7H2,1H3;2H,3-5H2,1H3 |
| InChIKey | NSNOBMJEGWUMRV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene?
The IUPAC name of 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene (CID 165038300) is 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene.
What is the SMILES notation for 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene?
The canonical SMILES for 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene is CC1=CCC2(CC1)COC2.CC1=CCS(=O)(=O)CC1.
What is the InChIKey of 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene?
The InChIKey is NSNOBMJEGWUMRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O.C6H10O2S/c1-8-2-4-9(5-3-8)6-10-7-9;1-6-2-4-9(7,8)5-3-6/h2H,3-7H2,1H3;2H,3-5H2,1H3.
What are the key properties of 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene?
4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene has a molecular weight of 284.42 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,6-dihydro-2H-thiopyran 1,1-dioxide;7-methyl-2-oxaspiro[3.5]non-6-ene is sourced from PubChem (CID 165038300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).