C27H25F2N7 — CID 165038429
2-[2-cyano-3-[7-[[(3E)-2-cyano-3-[cyano(isocyano)methylidene]-5-fluorocyclohexen-1-yl]amino]heptyl]-5-fluorocyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 165038429) has the molecular formula C27H25F2N7 and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-[2-cyano-3-[7-[[(3E)-2-cyano-3-[cyano(isocyano)methylidene]-5-fluorocyclohexen-1-yl]amino]heptyl]-5-fluorocyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[2-cyano-3-[7-[[(3E)-2-cyano-3-[cyano(isocyano)methylidene]-5-fluorocyclohexen-1-yl]amino]heptyl]-5-fluorocyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 165038429 |
| Molecular Formula | C27H25F2N7 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-[2-cyano-3-[7-[[(3E)-2-cyano-3-[cyano(isocyano)methylidene]-5-fluorocyclohexen-1-yl]amino]heptyl]-5-fluorocyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\CC(F)CC(NCCCCCCCC2=C(C#N)C(=C(C#N)C#N)CC(F)C2)=C1C#N |
| InChI | InChI=1S/C27H25F2N7/c1-35-27(17-34)23-11-21(29)12-26(25(23)16-33)36-8-6-4-2-3-5-7-18-9-20(28)10-22(24(18)15-32)19(13-30)14-31/h20-21,36H,2-12H2/b27-23+ |
| InChIKey | UANXLLHWZLXQKR-SLEBQGDGSA-N |
| XLogP | 5.82 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|