C25H37B2Br3N2O5 — CID 165039712
2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;2,5-dibromopyridine;4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane (PubChem CID 165039712) has the molecular formula C25H37B2Br3N2O5 and a molecular weight of 706.92 g/mol. Its IUPAC name is 2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;2,5-dibromopyridine;4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane.
| Compound Name | 2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;2,5-dibromopyridine;4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165039712 |
| Molecular Formula | C25H37B2Br3N2O5 |
| Molecular Weight | 706.92 g/mol |
| Exact Mass | 704.04 |
| IUPAC Name | 2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;2,5-dibromopyridine;4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane |
| SMILES | Brc1ccc(Br)nc1.CC(C)OB1OC(C)(C)C(C)(C)O1.CC1(C)OB(c2ccc(Br)nc2)OC1(C)C |
| InChI | InChI=1S/C11H15BBrNO2.C9H19BO3.C5H3Br2N/c1-10(2)11(3,4)16-12(15-10)8-5-6-9(13)14-7-8;1-7(2)11-10-12-8(3,4)9(5,6)13-10;6-4-1-2-5(7)8-3-4/h5-7H,1-4H3;7H,1-6H3;1-3H |
| InChIKey | NXTZXMKJQMQFJF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.92 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|