C26H26O6 — CID 165039991
9-[(3,3-dimethyloxiran-2-yl)methyl]-8-hydroxy-12,12-dimethyl-5-(4-methylphenyl)-3,11,14-trioxatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2(7),4,8-tetraen-6-one (PubChem CID 165039991) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 9-[(3,3-dimethyloxiran-2-yl)methyl]-8-hydroxy-12,12-dimethyl-5-(4-methylphenyl)-3,11,14-trioxatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2(7),4,8-tetraen-6-one.
| Compound Name | 9-[(3,3-dimethyloxiran-2-yl)methyl]-8-hydroxy-12,12-dimethyl-5-(4-methylphenyl)-3,11,14-trioxatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2(7),4,8-tetraen-6-one |
|---|---|
| PubChem CID | 165039991 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 9-[(3,3-dimethyloxiran-2-yl)methyl]-8-hydroxy-12,12-dimethyl-5-(4-methylphenyl)-3,11,14-trioxatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2(7),4,8-tetraen-6-one |
| SMILES | Cc1ccc(-c2coc3c4c(c(CC5OC5(C)C)c(O)c3c2=O)OC(C)(C)C2OC42)cc1 |
| InChI | InChI=1S/C26H26O6/c1-12-6-8-13(9-7-12)15-11-29-22-17(20(15)28)19(27)14(10-16-25(2,3)31-16)21-18(22)23-24(30-23)26(4,5)32-21/h6-9,11,16,23-24,27H,10H2,1-5H3 |
| InChIKey | RQKQWLZUKJAALI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|