C15H14F3N3O5S — CID 165040167
4-oxo-6-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]hexanoic acid;2,2,2-trifluoroacetate (PubChem CID 165040167) has the molecular formula C15H14F3N3O5S and a molecular weight of 405.35 g/mol. Its IUPAC name is 4-oxo-6-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]hexanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 4-oxo-6-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]hexanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 165040167 |
| Molecular Formula | C15H14F3N3O5S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-oxo-6-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]hexanoic acid;2,2,2-trifluoroacetate |
| SMILES | O=C(O)CCC(=O)CC[n+]1ccc(-c2nccs2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C13H13N3O3S.C2HF3O2/c17-11(1-2-12(18)19)4-7-16-6-3-10(9-15-16)13-14-5-8-20-13;3-2(4,5)1(6)7/h3,5-6,8-9H,1-2,4,7H2;(H,6,7) |
| InChIKey | JOOMRUVBWKNNGN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|