C39H30N6O2S2 — CID 165041868
3-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione (PubChem CID 165041868) has the molecular formula C39H30N6O2S2 and a molecular weight of 678.84 g/mol. Its IUPAC name is 3-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione.
| Compound Name | 3-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione |
|---|---|
| PubChem CID | 165041868 |
| Molecular Formula | C39H30N6O2S2 |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | 3-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3cc4c(cc(/N=C5\C(=O)C(=O)C6CCCCC56)c5nsnc54)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C39H30N6O2S2/c1-21-7-13-24(14-8-21)45(25-15-9-22(2)10-16-25)26-17-11-23(12-18-26)29-19-30-31(34-33(29)41-48-42-34)20-32(37-35(30)43-49-44-37)40-36-27-5-3-4-6-28(27)38(46)39(36)47/h7-20,27-28H,3-6H2,1-2H3/b40-36- |
| InChIKey | XAFFAVRXEOCZAK-NJMFHTGSSA-N |
| XLogP | 9.63 |
| TPSA | 101.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|