C21H20FN5O3S — CID 16504285
N-(2-cyanoethyl)-2-[[4-(2-fluorophenyl)-5-[(4-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 16504285) has the molecular formula C21H20FN5O3S and a molecular weight of 441.49 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[[4-(2-fluorophenyl)-5-[(4-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[[4-(2-fluorophenyl)-5-[(4-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16504285 |
| Molecular Formula | C21H20FN5O3S |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-(2-cyanoethyl)-2-[[4-(2-fluorophenyl)-5-[(4-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(OCc2nnc(SCC(=O)NCCC#N)n2-c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H20FN5O3S/c1-29-15-7-9-16(10-8-15)30-13-19-25-26-21(31-14-20(28)24-12-4-11-23)27(19)18-6-3-2-5-17(18)22/h2-3,5-10H,4,12-14H2,1H3,(H,24,28) |
| InChIKey | AEEMHIMYQFEOQX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|