C24H18F5NO3S — CID 165042854
2,3,4,5-tetrafluoro-N-[(4-fluorophenyl)methyl]-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide (PubChem CID 165042854) has the molecular formula C24H18F5NO3S and a molecular weight of 495.47 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[(4-fluorophenyl)methyl]-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[(4-fluorophenyl)methyl]-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 165042854 |
| Molecular Formula | C24H18F5NO3S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[(4-fluorophenyl)methyl]-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide |
| SMILES | CC(=O)/C=C/c1ccc(CN(Cc2ccc(F)cc2)S(=O)(=O)c2cc(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H18F5NO3S/c1-15(31)2-3-16-4-6-17(7-5-16)13-30(14-18-8-10-19(25)11-9-18)34(32,33)21-12-20(26)22(27)24(29)23(21)28/h2-12H,13-14H2,1H3/b3-2+ |
| InChIKey | DKMDOAFXCCBWJB-NSCUHMNNSA-N |
| XLogP | 5.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|