C26H24F4N2O3S — CID 165042857
N-[[4-(dimethylamino)phenyl]methyl]-2,3,4,5-tetrafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide (PubChem CID 165042857) has the molecular formula C26H24F4N2O3S and a molecular weight of 520.55 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2,3,4,5-tetrafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2,3,4,5-tetrafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 165042857 |
| Molecular Formula | C26H24F4N2O3S |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2,3,4,5-tetrafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide |
| SMILES | CC(=O)/C=C/c1ccc(CN(Cc2ccc(N(C)C)cc2)S(=O)(=O)c2cc(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C26H24F4N2O3S/c1-17(33)4-5-18-6-8-19(9-7-18)15-32(16-20-10-12-21(13-11-20)31(2)3)36(34,35)23-14-22(27)24(28)26(30)25(23)29/h4-14H,15-16H2,1-3H3/b5-4+ |
| InChIKey | JOVNKOGYDZVYTK-SNAWJCMRSA-N |
| XLogP | 5.30 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|