C15H31NO3Si — CID 165044908
trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate (PubChem CID 165044908) has the molecular formula C15H31NO3Si and a molecular weight of 301.50 g/mol. Its IUPAC name is trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate.
| Compound Name | trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 165044908 |
| Molecular Formula | C15H31NO3Si |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](C)C(=O)N(C)[C@H](C(=O)O[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C15H31NO3Si/c1-10(2)12(5)14(17)16(6)13(11(3)4)15(18)19-20(7,8)9/h10-13H,1-9H3/t12-,13-/m0/s1 |
| InChIKey | CGHHFCBARGGFKS-STQMWFEESA-N |
| XLogP | 3.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|