About trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate
trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate (PubChem CID 165044908) has the molecular formula C15H31NO3Si
and a molecular weight of 301.50 g/mol. Its IUPAC name is trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate.
Molecular Properties
| Compound Name | trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate |
| PubChem CID | 165044908 |
| Molecular Formula | C15H31NO3Si |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](C)C(=O)N(C)[C@H](C(=O)O[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C15H31NO3Si/c1-10(2)12(5)14(17)16(6)13(11(3)4)15(18)19-20(7,8)9/h10-13H,1-9H3/t12-,13-/m0/s1 |
| InChIKey | CGHHFCBARGGFKS-STQMWFEESA-N |
| XLogP | 3.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate?
The IUPAC name of trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate (CID 165044908) is trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate.
What is the SMILES notation for trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate?
The canonical SMILES for trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate is CC(C)[C@H](C)C(=O)N(C)[C@H](C(=O)O[Si](C)(C)C)C(C)C.
What is the InChIKey of trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate?
The InChIKey is CGHHFCBARGGFKS-STQMWFEESA-N. The full InChI is InChI=1S/C15H31NO3Si/c1-10(2)12(5)14(17)16(6)13(11(3)4)15(18)19-20(7,8)9/h10-13H,1-9H3/t12-,13-/m0/s1.
What are the key properties of trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate?
trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate has a molecular weight of 301.50 g/mol, XLogP of 3.14, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl (2S)-2-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methylbutanoate is sourced from PubChem (CID 165044908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).