C23H34N2O4Si — CID 165045024
prop-2-enyl (6S)-7-[tert-butyl(dimethyl)silyl]oxy-11,12-dimethyl-2-oxo-3,8-diazatricyclo[7.4.0.03,6]trideca-1(9),10,12-triene-8-carboxylate (PubChem CID 165045024) has the molecular formula C23H34N2O4Si and a molecular weight of 430.62 g/mol. Its IUPAC name is prop-2-enyl (6S)-7-[tert-butyl(dimethyl)silyl]oxy-11,12-dimethyl-2-oxo-3,8-diazatricyclo[7.4.0.03,6]trideca-1(9),10,12-triene-8-carboxylate.
| Compound Name | prop-2-enyl (6S)-7-[tert-butyl(dimethyl)silyl]oxy-11,12-dimethyl-2-oxo-3,8-diazatricyclo[7.4.0.03,6]trideca-1(9),10,12-triene-8-carboxylate |
|---|---|
| PubChem CID | 165045024 |
| Molecular Formula | C23H34N2O4Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | prop-2-enyl (6S)-7-[tert-butyl(dimethyl)silyl]oxy-11,12-dimethyl-2-oxo-3,8-diazatricyclo[7.4.0.03,6]trideca-1(9),10,12-triene-8-carboxylate |
| SMILES | C=CCOC(=O)N1c2cc(C)c(C)cc2C(=O)N2CC[C@H]2C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H34N2O4Si/c1-9-12-28-22(27)25-19-14-16(3)15(2)13-17(19)20(26)24-11-10-18(24)21(25)29-30(7,8)23(4,5)6/h9,13-14,18,21H,1,10-12H2,2-8H3/t18-,21?/m0/s1 |
| InChIKey | NHTGZBDNBGQVEN-YMXDCFFPSA-N |
| XLogP | 5.01 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|