C22H26F4N2O2 — CID 165049858
[(4aR,8aS)-3-methylidene-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-6-yl]-[3-[2-[2-fluoro-6-(trifluoromethyl)phenyl]ethyl]azetidin-1-yl](111C)methanone (PubChem CID 165049858) has the molecular formula C22H26F4N2O2 and a molecular weight of 425.45 g/mol. Its IUPAC name is [(4aR,8aS)-3-methylidene-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-6-yl]-[3-[2-[2-fluoro-6-(trifluoromethyl)phenyl]ethyl]azetidin-1-yl](111C)methanone.
| Compound Name | [(4aR,8aS)-3-methylidene-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-6-yl]-[3-[2-[2-fluoro-6-(trifluoromethyl)phenyl]ethyl]azetidin-1-yl](111C)methanone |
|---|---|
| PubChem CID | 165049858 |
| Molecular Formula | C22H26F4N2O2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [(4aR,8aS)-3-methylidene-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-6-yl]-[3-[2-[2-fluoro-6-(trifluoromethyl)phenyl]ethyl]azetidin-1-yl](111C)methanone |
| SMILES | C=C1CO[C@H]2CCN([11C](=O)N3CC(CCc4c(F)cccc4C(F)(F)F)C3)C[C@H]2C1 |
| InChI | InChI=1S/C22H26F4N2O2/c1-14-9-16-12-27(8-7-20(16)30-13-14)21(29)28-10-15(11-28)5-6-17-18(22(24,25)26)3-2-4-19(17)23/h2-4,15-16,20H,1,5-13H2/t16-,20+/m1/s1/i21-1 |
| InChIKey | WXGFCGYRXYYUNE-SCQSVAJQSA-N |
| XLogP | 4.50 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|