C11H8F3N3O4S — CID 165050335
2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]acetic acid;2,2,2-trifluoroacetate (PubChem CID 165050335) has the molecular formula C11H8F3N3O4S and a molecular weight of 335.26 g/mol. Its IUPAC name is 2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]acetic acid;2,2,2-trifluoroacetate.
| Compound Name | 2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]acetic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 165050335 |
| Molecular Formula | C11H8F3N3O4S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]acetic acid;2,2,2-trifluoroacetate |
| SMILES | O=C(O)C[n+]1ccc(-c2ncns2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C9H7N3O2S.C2HF3O2/c13-8(14)5-12-3-1-7(2-4-12)9-10-6-11-15-9;3-2(4,5)1(6)7/h1-4,6H,5H2;(H,6,7) |
| InChIKey | DWKNTBRSPXRDQI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|