About methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium
methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium (PubChem CID 165052296) has the molecular formula C7H11F3NO2S+
and a molecular weight of 230.23 g/mol. Its IUPAC name is methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium.
Molecular Properties
| Compound Name | methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium |
| PubChem CID | 165052296 |
| Molecular Formula | C7H11F3NO2S+ |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium |
| SMILES | C=[S+]CCCNC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C7H10F3NO2S/c1-14-4-2-3-11-6(12)13-5-7(8,9)10/h1-5H2/p+1 |
| InChIKey | PVXGSZDBOOZQOW-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium?
The IUPAC name of methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium (CID 165052296) is methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium.
What is the SMILES notation for methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium?
The canonical SMILES for methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium is C=[S+]CCCNC(=O)OCC(F)(F)F.
What is the InChIKey of methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium?
The InChIKey is PVXGSZDBOOZQOW-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H10F3NO2S/c1-14-4-2-3-11-6(12)13-5-7(8,9)10/h1-5H2/p+1.
What are the key properties of methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium?
methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium has a molecular weight of 230.23 g/mol, XLogP of 1.18, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylidene-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]sulfanium is sourced from PubChem (CID 165052296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).