About 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate
2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 16505260) has the molecular formula C19H16ClNO4
and a molecular weight of 357.79 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| PubChem CID | 16505260 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)OCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H16ClNO4/c1-13-17(18(21-25-13)14-6-3-2-4-7-14)19(22)24-11-10-23-16-9-5-8-15(20)12-16/h2-9,12H,10-11H2,1H3 |
| InChIKey | RONIQHKUFLXNHU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The IUPAC name of 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (CID 16505260) is 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate is Cc1onc(-c2ccccc2)c1C(=O)OCCOc1cccc(Cl)c1.
What is the InChIKey of 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The InChIKey is RONIQHKUFLXNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClNO4/c1-13-17(18(21-25-13)14-6-3-2-4-7-14)19(22)24-11-10-23-16-9-5-8-15(20)12-16/h2-9,12H,10-11H2,1H3.
What are the key properties of 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate has a molecular weight of 357.79 g/mol, XLogP of 4.54, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 16505260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).