About [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate
[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate (PubChem CID 16505321) has the molecular formula C21H16ClF3N2O4S
and a molecular weight of 484.88 g/mol. Its IUPAC name is [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate.
Molecular Properties
| Compound Name | [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate |
| PubChem CID | 16505321 |
| Molecular Formula | C21H16ClF3N2O4S |
| Molecular Weight | 484.88 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)OCc1csc(N(C(C)=O)c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H16ClF3N2O4S/c1-12(28)27(16-5-3-4-13(8-16)21(23,24)25)20-26-15(11-32-20)10-31-19(29)17-9-14(22)6-7-18(17)30-2/h3-9,11H,10H2,1-2H3 |
| InChIKey | WSADMEPEDZROGH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.88 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate?
The IUPAC name of [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate (CID 16505321) is [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate.
What is the SMILES notation for [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate?
The canonical SMILES for [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate is COc1ccc(Cl)cc1C(=O)OCc1csc(N(C(C)=O)c2cccc(C(F)(F)F)c2)n1.
What is the InChIKey of [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate?
The InChIKey is WSADMEPEDZROGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClF3N2O4S/c1-12(28)27(16-5-3-4-13(8-16)21(23,24)25)20-26-15(11-32-20)10-31-19(29)17-9-14(22)6-7-18(17)30-2/h3-9,11H,10H2,1-2H3.
What are the key properties of [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate?
[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate has a molecular weight of 484.88 g/mol, XLogP of 5.87, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 5-chloro-2-methoxybenzoate is sourced from PubChem (CID 16505321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).