C41H28BClN3O- — CID 165053347
boranuide;2-[3-(11-chloro-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,3,5,7,9,11,13,15,17,19-decaen-4-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 165053347) has the molecular formula C41H28BClN3O- and a molecular weight of 624.96 g/mol. Its IUPAC name is boranuide;2-[3-(11-chloro-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,3,5,7,9,11,13,15,17,19-decaen-4-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | boranuide;2-[3-(11-chloro-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,3,5,7,9,11,13,15,17,19-decaen-4-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 165053347 |
| Molecular Formula | C41H28BClN3O- |
| Molecular Weight | 624.96 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | boranuide;2-[3-(11-chloro-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,3,5,7,9,11,13,15,17,19-decaen-4-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Clc1ccc2c3ccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)cc3c3oc4ccccc4c3c2c1.[BH4-] |
| InChI | InChI=1S/C41H24ClN3O.BH4/c42-30-19-21-31-32-20-18-28(23-35(32)38-37(34(31)24-30)33-16-7-8-17-36(33)46-38)27-14-9-15-29(22-27)41-44-39(25-10-3-1-4-11-25)43-40(45-41)26-12-5-2-6-13-26;/h1-24H;1H4/q;-1 |
| InChIKey | QACOQQALPJLOEL-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.96 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|