C14H21ClN6O — CID 165053605
3-[4-chloro-6-[(3R)-3-methylmorpholin-4-yl]-1,3,5-triazin-2-yl]-4-methyliminopent-2-en-2-amine (PubChem CID 165053605) has the molecular formula C14H21ClN6O and a molecular weight of 324.82 g/mol. Its IUPAC name is 3-[4-chloro-6-[(3R)-3-methylmorpholin-4-yl]-1,3,5-triazin-2-yl]-4-methyliminopent-2-en-2-amine.
| Compound Name | 3-[4-chloro-6-[(3R)-3-methylmorpholin-4-yl]-1,3,5-triazin-2-yl]-4-methyliminopent-2-en-2-amine |
|---|---|
| PubChem CID | 165053605 |
| Molecular Formula | C14H21ClN6O |
| Molecular Weight | 324.82 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-[4-chloro-6-[(3R)-3-methylmorpholin-4-yl]-1,3,5-triazin-2-yl]-4-methyliminopent-2-en-2-amine |
| SMILES | C/N=C(\C)C(=C(C)N)c1nc(Cl)nc(N2CCOC[C@H]2C)n1 |
| InChI | InChI=1S/C14H21ClN6O/c1-8-7-22-6-5-21(8)14-19-12(18-13(15)20-14)11(9(2)16)10(3)17-4/h8H,5-7,16H2,1-4H3/b11-9?,17-10+/t8-/m1/s1 |
| InChIKey | LDBJNDHFVYEQMQ-WCRCODQVSA-N |
| XLogP | 1.53 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.82 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|