C12H8F6N3O4S+ — CID 165053662
2,2,2-trifluoroacetic acid;2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]acetic acid (PubChem CID 165053662) has the molecular formula C12H8F6N3O4S+ and a molecular weight of 404.27 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]acetic acid.
| Compound Name | 2,2,2-trifluoroacetic acid;2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 165053662 |
| Molecular Formula | C12H8F6N3O4S+ |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]acetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C[n+]1ccc(-c2nc(C(F)(F)F)ns2)cc1 |
| InChI | InChI=1S/C10H6F3N3O2S.C2HF3O2/c11-10(12,13)9-14-8(19-15-9)6-1-3-16(4-2-6)5-7(17)18;3-2(4,5)1(6)7/h1-4H,5H2;(H,6,7)/p+1 |
| InChIKey | CJDOZZWLXWHLTJ-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|