About CID 165053916
CID 165053916 (PubChem CID 165053916) has the molecular formula C27H27BN2O2+
and a molecular weight of 422.34 g/mol.
Molecular Properties
| Compound Name | CID 165053916 |
| PubChem CID | 165053916 |
| Molecular Formula | C27H27BN2O2+ |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | — |
| SMILES | CC(C)([OH2+])C(C)(C)O[B]c1ccc(-c2nc3ccccc3c3[nH]c4ccccc4c23)cc1 |
| InChI | InChI=1S/C27H26BN2O2/c1-26(2,31)27(3,4)32-28-18-15-13-17(14-16-18)24-23-19-9-5-7-11-21(19)30-25(23)20-10-6-8-12-22(20)29-24/h5-16,30-31H,1-4H3/p+1 |
| InChIKey | ACLOTEXGVBMYBA-UHFFFAOYSA-O |
| XLogP | 5.08 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 165053916 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165053916?
The IUPAC name of CID 165053916 (CID 165053916) is not available.
What is the SMILES notation for CID 165053916?
The canonical SMILES for CID 165053916 is CC(C)([OH2+])C(C)(C)O[B]c1ccc(-c2nc3ccccc3c3[nH]c4ccccc4c23)cc1.
What is the InChIKey of CID 165053916?
The InChIKey is ACLOTEXGVBMYBA-UHFFFAOYSA-O. The full InChI is InChI=1S/C27H26BN2O2/c1-26(2,31)27(3,4)32-28-18-15-13-17(14-16-18)24-23-19-9-5-7-11-21(19)30-25(23)20-10-6-8-12-22(20)29-24/h5-16,30-31H,1-4H3/p+1.
What are the key properties of CID 165053916?
CID 165053916 has a molecular weight of 422.34 g/mol, XLogP of 5.08, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165053916 is sourced from PubChem (CID 165053916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).