C16H18F3N3O6S2 — CID 165054087
2,2-dimethyl-3-[2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]ethylsulfonyl]propanoic acid;2,2,2-trifluoroacetate (PubChem CID 165054087) has the molecular formula C16H18F3N3O6S2 and a molecular weight of 469.46 g/mol. Its IUPAC name is 2,2-dimethyl-3-[2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]ethylsulfonyl]propanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 2,2-dimethyl-3-[2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]ethylsulfonyl]propanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 165054087 |
| Molecular Formula | C16H18F3N3O6S2 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 2,2-dimethyl-3-[2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]ethylsulfonyl]propanoic acid;2,2,2-trifluoroacetate |
| SMILES | CC(C)(CS(=O)(=O)CC[n+]1ccc(-c2nccs2)cn1)C(=O)O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H17N3O4S2.C2HF3O2/c1-14(2,13(18)19)10-23(20,21)8-6-17-5-3-11(9-16-17)12-15-4-7-22-12;3-2(4,5)1(6)7/h3-5,7,9H,6,8,10H2,1-2H3;(H,6,7) |
| InChIKey | LXHBEZGZQADMFD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|