About (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane
(2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane (PubChem CID 165054872) has the molecular formula C12H26N2OS
and a molecular weight of 247.43 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane.
Molecular Properties
| Compound Name | (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane |
| PubChem CID | 165054872 |
| Molecular Formula | C12H26N2OS |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane |
| SMILES | CN[C@@H](CSC)C(=O)NC1CCCCC1.[2H]C |
| InChI | InChI=1S/C11H22N2OS.CH4/c1-12-10(8-15-2)11(14)13-9-6-4-3-5-7-9;/h9-10,12H,3-8H2,1-2H3,(H,13,14);1H4/t10-;/m0./s1/i;1D |
| InChIKey | QGAWNBZGISDLRR-MPJFZFKHSA-N |
| XLogP | 2.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane?
The IUPAC name of (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane (CID 165054872) is (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane.
What is the SMILES notation for (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane?
The canonical SMILES for (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane is CN[C@@H](CSC)C(=O)NC1CCCCC1.[2H]C.
What is the InChIKey of (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane?
The InChIKey is QGAWNBZGISDLRR-MPJFZFKHSA-N. The full InChI is InChI=1S/C11H22N2OS.CH4/c1-12-10(8-15-2)11(14)13-9-6-4-3-5-7-9;/h9-10,12H,3-8H2,1-2H3,(H,13,14);1H4/t10-;/m0./s1/i;1D.
What are the key properties of (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane?
(2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane has a molecular weight of 247.43 g/mol, XLogP of 2.02, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-cyclohexyl-2-(methylamino)-3-methylsulfanylpropanamide;deuteriomethane is sourced from PubChem (CID 165054872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).