C26H23FN6O — CID 165057205
4-(5-fluoro-3-pyridinyl)-N-[(3R)-2,3,4,9-tetrahydro-1H-fluoren-3-yl]-12-oxa-3,5,7,8-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-6-amine (PubChem CID 165057205) has the molecular formula C26H23FN6O and a molecular weight of 454.51 g/mol. Its IUPAC name is 4-(5-fluoro-3-pyridinyl)-N-[(3R)-2,3,4,9-tetrahydro-1H-fluoren-3-yl]-12-oxa-3,5,7,8-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-6-amine.
| Compound Name | 4-(5-fluoro-3-pyridinyl)-N-[(3R)-2,3,4,9-tetrahydro-1H-fluoren-3-yl]-12-oxa-3,5,7,8-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-6-amine |
|---|---|
| PubChem CID | 165057205 |
| Molecular Formula | C26H23FN6O |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 4-(5-fluoro-3-pyridinyl)-N-[(3R)-2,3,4,9-tetrahydro-1H-fluoren-3-yl]-12-oxa-3,5,7,8-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-6-amine |
| SMILES | Fc1cncc(-c2nc(N[C@@H]3CCC4=C(C3)c3ccccc3C4)n3nc4c(c3n2)COCC4)c1 |
| InChI | InChI=1S/C26H23FN6O/c27-18-10-17(12-28-13-18)24-30-25-22-14-34-8-7-23(22)32-33(25)26(31-24)29-19-6-5-16-9-15-3-1-2-4-20(15)21(16)11-19/h1-4,10,12-13,19H,5-9,11,14H2,(H,29,30,31)/t19-/m1/s1 |
| InChIKey | QPUMDTDAYJQORH-LJQANCHMSA-N |
| XLogP | 4.37 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |