C26H40 — CID 165057381
buta-1,3-diene;4-(cyclohex-3-en-1-ylmethyl)cyclohexene;4-prop-2-enylcyclohexene (PubChem CID 165057381) has the molecular formula C26H40 and a molecular weight of 352.61 g/mol. Its IUPAC name is buta-1,3-diene;4-(cyclohex-3-en-1-ylmethyl)cyclohexene;4-prop-2-enylcyclohexene.
| Compound Name | buta-1,3-diene;4-(cyclohex-3-en-1-ylmethyl)cyclohexene;4-prop-2-enylcyclohexene |
|---|---|
| PubChem CID | 165057381 |
| Molecular Formula | C26H40 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | buta-1,3-diene;4-(cyclohex-3-en-1-ylmethyl)cyclohexene;4-prop-2-enylcyclohexene |
| SMILES | C1=CCC(CC2CC=CCC2)CC1.C=CC=C.C=CCC1CC=CCC1 |
| InChI | InChI=1S/C13H20.C9H14.C4H6/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2-6-9-7-4-3-5-8-9;1-3-4-2/h1-3,5,12-13H,4,6-11H2;2-4,9H,1,5-8H2;3-4H,1-2H2 |
| InChIKey | QQKLTUHPCFZDSV-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|