C39H51F4O5P — CID 165057433
4-(1-adamantyl)-2,3-difluorophenol;1-[4-(3-diethoxyphosphorylpropoxy)-2,3-difluorophenyl]adamantane (PubChem CID 165057433) has the molecular formula C39H51F4O5P and a molecular weight of 706.80 g/mol. Its IUPAC name is 4-(1-adamantyl)-2,3-difluorophenol;1-[4-(3-diethoxyphosphorylpropoxy)-2,3-difluorophenyl]adamantane.
| Compound Name | 4-(1-adamantyl)-2,3-difluorophenol;1-[4-(3-diethoxyphosphorylpropoxy)-2,3-difluorophenyl]adamantane |
|---|---|
| PubChem CID | 165057433 |
| Molecular Formula | C39H51F4O5P |
| Molecular Weight | 706.80 g/mol |
| Exact Mass | 706.34 |
| IUPAC Name | 4-(1-adamantyl)-2,3-difluorophenol;1-[4-(3-diethoxyphosphorylpropoxy)-2,3-difluorophenyl]adamantane |
| SMILES | CCOP(=O)(CCCOc1ccc(C23CC4CC(CC(C4)C2)C3)c(F)c1F)OCC.Oc1ccc(C23CC4CC(CC(C4)C2)C3)c(F)c1F |
| InChI | InChI=1S/C23H33F2O4P.C16H18F2O/c1-3-28-30(26,29-4-2)9-5-8-27-20-7-6-19(21(24)22(20)25)23-13-16-10-17(14-23)12-18(11-16)15-23;17-14-12(1-2-13(19)15(14)18)16-6-9-3-10(7-16)5-11(4-9)8-16/h6-7,16-18H,3-5,8-15H2,1-2H3;1-2,9-11,19H,3-8H2 |
| InChIKey | QQOKTWYCBLAGES-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.80 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|