About (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene
(3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene (PubChem CID 165057582) has the molecular formula C18H32S
and a molecular weight of 280.52 g/mol. Its IUPAC name is (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene.
Molecular Properties
| Compound Name | (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene |
| PubChem CID | 165057582 |
| Molecular Formula | C18H32S |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene |
| SMILES | CCCSC1=C(C(C)C)CC(C)(C)C/C1=C\C(C)C |
| InChI | InChI=1S/C18H32S/c1-8-9-19-17-15(10-13(2)3)11-18(6,7)12-16(17)14(4)5/h10,13-14H,8-9,11-12H2,1-7H3/b15-10+ |
| InChIKey | QRHJQRABOPXUGI-XNTDXEJSSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene?
The IUPAC name of (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene (CID 165057582) is (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene.
What is the SMILES notation for (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene?
The canonical SMILES for (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene is CCCSC1=C(C(C)C)CC(C)(C)C/C1=C\C(C)C.
What is the InChIKey of (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene?
The InChIKey is QRHJQRABOPXUGI-XNTDXEJSSA-N. The full InChI is InChI=1S/C18H32S/c1-8-9-19-17-15(10-13(2)3)11-18(6,7)12-16(17)14(4)5/h10,13-14H,8-9,11-12H2,1-7H3/b15-10+.
What are the key properties of (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene?
(3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene has a molecular weight of 280.52 g/mol, XLogP of 6.44, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5,5-dimethyl-3-(2-methylpropylidene)-1-propan-2-yl-2-propylsulfanylcyclohexene is sourced from PubChem (CID 165057582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).