C17H26O2 — CID 165059831
2-cyclohex-2-en-1-ylpent-3-yn-2-yl 2,2-dimethylbutanoate (PubChem CID 165059831) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-ylpent-3-yn-2-yl 2,2-dimethylbutanoate.
| Compound Name | 2-cyclohex-2-en-1-ylpent-3-yn-2-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 165059831 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-cyclohex-2-en-1-ylpent-3-yn-2-yl 2,2-dimethylbutanoate |
| SMILES | CC#CC(C)(OC(=O)C(C)(C)CC)C1C=CCCC1 |
| InChI | InChI=1S/C17H26O2/c1-6-13-17(5,14-11-9-8-10-12-14)19-15(18)16(3,4)7-2/h9,11,14H,7-8,10,12H2,1-5H3 |
| InChIKey | YSDFRGHNHCKYNE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|