C17H36O3Si — CID 165060017
4-(2,2-dimethylpropoxymethyl)-2,2-dimethyl-4-trimethylsilyloxyhexan-3-one (PubChem CID 165060017) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is 4-(2,2-dimethylpropoxymethyl)-2,2-dimethyl-4-trimethylsilyloxyhexan-3-one.
| Compound Name | 4-(2,2-dimethylpropoxymethyl)-2,2-dimethyl-4-trimethylsilyloxyhexan-3-one |
|---|---|
| PubChem CID | 165060017 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 4-(2,2-dimethylpropoxymethyl)-2,2-dimethyl-4-trimethylsilyloxyhexan-3-one |
| SMILES | CCC(COCC(C)(C)C)(O[Si](C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H36O3Si/c1-11-17(20-21(8,9)10,14(18)16(5,6)7)13-19-12-15(2,3)4/h11-13H2,1-10H3 |
| InChIKey | CHVKZAQCPIZDRP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|