C61H50F2N2O8 — CID 165061889
(2S)-2-[(3-cyano-5-fluorophenyl)methoxy]-3-trityloxypropanoic acid;methyl (2S)-2-[(3-cyano-5-fluorophenyl)methoxy]-3-trityloxypropanoate (PubChem CID 165061889) has the molecular formula C61H50F2N2O8 and a molecular weight of 977.07 g/mol. Its IUPAC name is (2S)-2-[(3-cyano-5-fluorophenyl)methoxy]-3-trityloxypropanoic acid;methyl (2S)-2-[(3-cyano-5-fluorophenyl)methoxy]-3-trityloxypropanoate.
| Compound Name | (2S)-2-[(3-cyano-5-fluorophenyl)methoxy]-3-trityloxypropanoic acid;methyl (2S)-2-[(3-cyano-5-fluorophenyl)methoxy]-3-trityloxypropanoate |
|---|---|
| PubChem CID | 165061889 |
| Molecular Formula | C61H50F2N2O8 |
| Molecular Weight | 977.07 g/mol |
| Exact Mass | 976.35 |
| IUPAC Name | (2S)-2-[(3-cyano-5-fluorophenyl)methoxy]-3-trityloxypropanoic acid;methyl (2S)-2-[(3-cyano-5-fluorophenyl)methoxy]-3-trityloxypropanoate |
| SMILES | COC(=O)[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OCc1cc(F)cc(C#N)c1.N#Cc1cc(F)cc(CO[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C31H26FNO4.C30H24FNO4/c1-35-30(34)29(36-21-24-17-23(20-33)18-28(32)19-24)22-37-31(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27;31-27-17-22(19-32)16-23(18-27)20-35-28(29(33)34)21-36-30(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h2-19,29H,21-22H2,1H3;1-18,28H,20-21H2,(H,33,34)/t29-;28-/m00/s1 |
| InChIKey | RIMDJEQAVIELMT-KGUXADCISA-N |
| XLogP | 11.44 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.07 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|