About [ethenyl(methyl)silyl]methyl butane-1-sulfonate
[ethenyl(methyl)silyl]methyl butane-1-sulfonate (PubChem CID 165062308) has the molecular formula C8H18O3SSi
and a molecular weight of 222.38 g/mol. Its IUPAC name is [ethenyl(methyl)silyl]methyl butane-1-sulfonate.
Molecular Properties
| Compound Name | [ethenyl(methyl)silyl]methyl butane-1-sulfonate |
| PubChem CID | 165062308 |
| Molecular Formula | C8H18O3SSi |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | [ethenyl(methyl)silyl]methyl butane-1-sulfonate |
| SMILES | C=C[SiH](C)COS(=O)(=O)CCCC |
| InChI | InChI=1S/C8H18O3SSi/c1-4-6-7-12(9,10)11-8-13(3)5-2/h5,13H,2,4,6-8H2,1,3H3 |
| InChIKey | XDJKRRRAAPSFHI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [ethenyl(methyl)silyl]methyl butane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethenyl(methyl)silyl]methyl butane-1-sulfonate?
The IUPAC name of [ethenyl(methyl)silyl]methyl butane-1-sulfonate (CID 165062308) is [ethenyl(methyl)silyl]methyl butane-1-sulfonate.
What is the SMILES notation for [ethenyl(methyl)silyl]methyl butane-1-sulfonate?
The canonical SMILES for [ethenyl(methyl)silyl]methyl butane-1-sulfonate is C=C[SiH](C)COS(=O)(=O)CCCC.
What is the InChIKey of [ethenyl(methyl)silyl]methyl butane-1-sulfonate?
The InChIKey is XDJKRRRAAPSFHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3SSi/c1-4-6-7-12(9,10)11-8-13(3)5-2/h5,13H,2,4,6-8H2,1,3H3.
What are the key properties of [ethenyl(methyl)silyl]methyl butane-1-sulfonate?
[ethenyl(methyl)silyl]methyl butane-1-sulfonate has a molecular weight of 222.38 g/mol, XLogP of 1.25, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [ethenyl(methyl)silyl]methyl butane-1-sulfonate is sourced from PubChem (CID 165062308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).