About [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium
[4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium (PubChem CID 165064101) has the molecular formula C20H13F3I3O2+
and a molecular weight of 723.03 g/mol. Its IUPAC name is [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium.
Molecular Properties
| Compound Name | [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium |
| PubChem CID | 165064101 |
| Molecular Formula | C20H13F3I3O2+ |
| Molecular Weight | 723.03 g/mol |
| Exact Mass | 722.80 |
| IUPAC Name | [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium |
| SMILES | Cc1cc(Oc2cc(I)c(O)cc2I)ccc1[I+]c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H12F3I3O2/c1-11-8-14(28-19-10-15(24)18(27)9-16(19)25)6-7-17(11)26-13-4-2-12(3-5-13)20(21,22)23/h2-10H,1H3/p+1 |
| InChIKey | RRKSYWUPHYEARC-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 723.03 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium?
The IUPAC name of [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium (CID 165064101) is [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium.
What is the SMILES notation for [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium?
The canonical SMILES for [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium is Cc1cc(Oc2cc(I)c(O)cc2I)ccc1[I+]c1ccc(C(F)(F)F)cc1.
What is the InChIKey of [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium?
The InChIKey is RRKSYWUPHYEARC-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H12F3I3O2/c1-11-8-14(28-19-10-15(24)18(27)9-16(19)25)6-7-17(11)26-13-4-2-12(3-5-13)20(21,22)23/h2-10H,1H3/p+1.
What are the key properties of [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium?
[4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium has a molecular weight of 723.03 g/mol, XLogP of 3.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-hydroxy-2,5-diiodophenoxy)-2-methylphenyl]-[4-(trifluoromethyl)phenyl]iodanium is sourced from PubChem (CID 165064101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).