C55H111N9O5 — CID 165064161
3-[bis[3-[bis[6-(diethylamino)-3-oxohexyl]amino]propyl]amino]-N-[2-(diethylamino)ethyl]propanamide (PubChem CID 165064161) has the molecular formula C55H111N9O5 and a molecular weight of 978.55 g/mol. Its IUPAC name is 3-[bis[3-[bis[6-(diethylamino)-3-oxohexyl]amino]propyl]amino]-N-[2-(diethylamino)ethyl]propanamide.
| Compound Name | 3-[bis[3-[bis[6-(diethylamino)-3-oxohexyl]amino]propyl]amino]-N-[2-(diethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 165064161 |
| Molecular Formula | C55H111N9O5 |
| Molecular Weight | 978.55 g/mol |
| Exact Mass | 977.87 |
| IUPAC Name | 3-[bis[3-[bis[6-(diethylamino)-3-oxohexyl]amino]propyl]amino]-N-[2-(diethylamino)ethyl]propanamide |
| SMILES | CCN(CC)CCCC(=O)CCN(CCCN(CCCN(CCC(=O)CCCN(CC)CC)CCC(=O)CCCN(CC)CC)CCC(=O)NCCN(CC)CC)CCC(=O)CCCN(CC)CC |
| InChI | InChI=1S/C55H111N9O5/c1-11-57(12-2)37-21-27-51(65)31-45-63(46-32-52(66)28-22-38-58(13-3)14-4)43-25-41-62(49-35-55(69)56-36-50-61(19-9)20-10)42-26-44-64(47-33-53(67)29-23-39-59(15-5)16-6)48-34-54(68)30-24-40-60(17-7)18-8/h11-50H2,1-10H3,(H,56,69) |
| InChIKey | HBGABXFBRZNUPD-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |